6022 -OEChem-02210610172D 42 44 0 1 0 0 0 0 0999 V2000 2.0000 -1.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2619 -1.5551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7523 2.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 -2.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8660 -2.5551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 -1.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9423 1.5075 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9917 1.8182 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.4025 1.0102 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9889 0.2002 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.8660 -3.5551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 -2.0551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.8660 -0.5551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6783 -2.3598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6783 -0.7504 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6844 2.7698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4025 1.0119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.1109 2.0417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6063 3.3629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0615 1.4619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7897 1.5372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8888 3.0820 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9405 0.5075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6651 1.6856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2852 2.8584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1980 2.4500 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 8.4752 2.2720 0.0000 P 0 0 3 0 0 0 0 0 0 0 0 0 1.4631 -0.7451 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8819 -1.5551 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0999 2.6073 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3070 2.5254 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4942 1.2251 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4309 2.2558 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1220 1.5631 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4266 -0.2390 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3291 -3.8651 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4030 -3.8651 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1000 3.2298 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0935 1.5494 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6131 2.4053 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2428 3.8651 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8084 0.8960 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 12 2 0 0 0 0 1 13 1 0 0 0 0 1 28 1 0 0 0 0 2 14 2 0 0 0 0 2 15 1 0 0 0 0 2 29 1 0 0 0 0 7 3 1 1 0 0 0 3 24 1 0 0 0 0 3 30 1 0 0 0 0 3 31 1 0 0 0 0 4 5 2 0 0 0 0 4 6 1 0 0 0 0 4 14 1 0 0 0 0 5 11 1 0 0 0 0 5 12 1 0 0 0 0 6 13 2 0 0 0 0 6 15 1 0 0 0 0 7 8 1 0 0 0 0 7 23 1 0 0 0 0 7 32 1 0 0 0 0 8 9 1 0 0 0 0 8 16 1 6 0 0 0 8 33 1 0 0 0 0 9 10 1 0 0 0 0 9 17 1 6 0 0 0 9 34 1 0 0 0 0 10 15 1 1 0 0 0 10 23 1 0 0 0 0 10 35 1 0 0 0 0 11 36 1 0 0 0 0 11 37 1 0 0 0 0 16 38 1 0 0 0 0 17 39 1 0 0 0 0 18 26 1 0 0 0 0 18 40 1 0 0 0 0 19 26 1 0 0 0 0 19 41 1 0 0 0 0 20 27 1 0 0 0 0 20 42 1 0 0 0 0 21 26 2 0 0 0 0 22 27 2 0 0 0 0 24 27 1 0 0 0 0 25 26 1 0 0 0 0 25 27 1 0 0 0 0 M END > 1 > 6022 > 15 > 6 > 6 > AAADcQO8c8AAAAAAAAAAAAAAAABAYgEAACwAAAAAAAABWAAAHgAA+CAIEADhHAgA8AUGlxAXTL9hBkGggICAZKAQES0oIFABWIMQVEDIQAIPCEQeANMCAAow8CAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA== > [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methoxy-hydroxy-phosphoryl]oxyphosphonic acid > [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methoxy-hydroxy-phosphoryl]oxyphosphonic acid > [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]oxyphosphonic acid > [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]oxyphosphonic acid > [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methoxy-hydroxy-phosphoryl]oxyphosphonic acid > InChI=1/C10H15N5O10P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-27(21,22)25-26(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1/f/h18-19,21H,11H2 > -2.253 > C10H15N5O10P2 > 427.201 > C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O > C1=NC2=C(C(=N1)N)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)O)O)O > 232.6 > 0 > 27 > 4 > 0 > 0 > 0 > 0 > 1 > 3 > 3310 > 2 > KEGG > C00008 > Is a reactant or product of enzyme EC 1.3.99.15 Is a reactant or product of enzyme EC 1.17.4.1 Is a reactant or product of enzyme EC 1.18.6.1 Is a reactant or product of enzyme EC 1.18.-.- Is a reactant or product of enzyme EC 1.19.6.1 Is a reactant or product of enzyme EC 2.1.1.45 Is a reactant or product of enzyme EC 2.1.2.- Is a reactant or product of enzyme EC 2.3.3.8 Is a reactant or product of enzyme EC 2.4.1.21 Is a reactant or product of enzyme EC 2.4.1.113 Is a reactant or product of enzyme EC 2.4.1.213 Is a reactant or product of enzyme EC 2.7.1.1 Is a reactant or product of enzyme EC 2.7.1.2 Is a reactant or product of enzyme EC 2.7.1.3 Is a reactant or product of enzyme EC 2.7.1.4 Is a reactant or product of enzyme EC 2.7.1.5 Is a reactant or product of enzyme EC 2.7.1.6 Is a reactant or product of enzyme EC 2.7.1.7 Is a reactant or product of enzyme EC 2.7.1.8 Is a reactant or product of enzyme EC 2.7.1.10 Is a reactant or product of enzyme EC 2.7.1.11 Is a reactant or product of enzyme EC 2.7.1.11 Is a reactant or product of enzyme EC 2.7.1.12 Is a reactant or product of enzyme EC 2.7.1.13 Is a reactant or product of enzyme EC 2.7.1.14 Is a reactant or product of enzyme EC 2.7.1.15 Is a reactant or product of enzyme EC 2.7.1.16 Is a reactant or product of enzyme EC 2.7.1.17 Is a reactant or product of enzyme EC 2.7.1.18 Is a reactant or product of enzyme EC 2.7.1.19 Is a reactant or product of enzyme EC 2.7.1.20 Is a reactant or product of enzyme EC 2.7.1.21 Is a reactant or product of enzyme EC 2.7.1.22 Is a reactant or product of enzyme EC 2.7.1.23 Is a reactant or product of enzyme EC 2.7.1.24 Is a reactant or product of enzyme EC 2.7.1.25 Is a reactant or product of enzyme EC 2.7.1.26 Is a reactant or product of enzyme EC 2.7.1.27 Is a reactant or product of enzyme EC 2.7.1.28 Is a reactant or product of enzyme EC 2.7.1.29 Is a reactant or product of enzyme EC 2.7.1.30 Is a reactant or product of enzyme EC 2.7.1.31 Is a reactant or product of enzyme EC 2.7.1.32 Is a reactant or product of enzyme EC 2.7.1.33 Is a reactant or product of enzyme EC 2.7.1.34 Is a reactant or product of enzyme EC 2.7.1.35 Is a reactant or product of enzyme EC 2.7.1.36 Is a reactant or product of enzyme EC 2.7.1.37 Is a reactant or product of enzyme EC 2.7.1.38 Is a reactant or product of enzyme EC 2.7.1.39 Is a reactant or product of enzyme EC 2.7.1.40 Is a reactant or product of enzyme EC 2.7.1.43 Is a reactant or product of enzyme EC 2.7.1.44 Is a reactant or product of enzyme EC 2.7.1.45 Is a reactant or product of enzyme EC 2.7.1.46 Is a reactant or product of enzyme EC 2.7.1.47 Is a reactant or product of enzyme EC 2.7.1.48 Is a reactant or product of enzyme EC 2.7.1.49 Is a reactant or product of enzyme EC 2.7.1.50 Is a reactant or product of enzyme EC 2.7.1.51 Is a reactant or product of enzyme EC 2.7.1.52 Is a reactant or product of enzyme EC 2.7.1.53 Is a reactant or product of enzyme EC 2.7.1.54 Is a reactant or product of enzyme EC 2.7.1.55 Is a reactant or product of enzyme EC 2.7.1.56 Is a reactant or product of enzyme EC 2.7.1.58 Is a reactant or product of enzyme EC 2.7.1.59 Is a reactant or product of enzyme EC 2.7.1.60 Is a reactant or product of enzyme EC 2.7.1.64 Is a reactant or product of enzyme EC 2.7.1.65 Is a reactant or product of enzyme EC 2.7.1.66 Is a reactant or product of enzyme EC 2.7.1.67 Is a reactant or product of enzyme EC 2.7.1.68 Is a reactant or product of enzyme EC 2.7.1.71 Is a reactant or product of enzyme EC 2.7.1.72 Is a reactant or product of enzyme EC 2.7.1.73 Is a reactant or product of enzyme EC 2.7.1.74 Is a reactant or product of enzyme EC 2.7.1.76 Is a reactant or product of enzyme EC 2.7.1.78 Is a reactant or product of enzyme EC 2.7.1.82 Is a reactant or product of enzyme EC 2.7.1.83 Is a reactant or product of enzyme EC 2.7.1.84 Is a reactant or product of enzyme EC 2.7.1.85 Is a reactant or product of enzyme EC 2.7.1.86 Is a reactant or product of enzyme EC 2.7.1.87 Is a reactant or product of enzyme EC 2.7.1.88 Is a reactant or product of enzyme EC 2.7.1.89 Is a reactant or product of enzyme EC 2.7.1.91 Is a reactant or product of enzyme EC 2.7.1.92 Is a reactant or product of enzyme EC 2.7.1.93 Is a reactant or product of enzyme EC 2.7.1.94 Is a reactant or product of enzyme EC 2.7.1.95 Is a reactant or product of enzyme EC 2.7.1.99 Is a reactant or product of enzyme EC 2.7.1.100 Is a reactant or product of enzyme EC 2.7.1.101 Is a reactant or product of enzyme EC 2.7.1.102 Is a reactant or product of enzyme EC 2.7.1.103 Is a reactant or product of enzyme EC 2.7.1.105 Is a reactant or product of enzyme EC 2.7.1.107 Is a reactant or product of enzyme EC 2.7.1.109 Is a reactant or product of enzyme EC 2.7.1.110 Is a reactant or product of enzyme EC 2.7.1.112 Is a reactant or product of enzyme EC 2.7.1.113 Is a reactant or product of enzyme EC 2.7.1.115 Is a reactant or product of enzyme EC 2.7.1.116 Is a reactant or product of enzyme EC 2.7.1.117 Is a reactant or product of enzyme EC 2.7.1.118 Is a reactant or product of enzyme EC 2.7.1.119 Is a reactant or product of enzyme EC 2.7.1.120 Is a reactant or product of enzyme EC 2.7.1.122 Is a reactant or product of enzyme EC 2.7.1.123 Is a reactant or product of enzyme EC 2.7.1.124 Is a reactant or product of enzyme EC 2.7.1.125 Is a reactant or product of enzyme EC 2.7.1.126 Is a reactant or product of enzyme EC 2.7.1.127 Is a reactant or product of enzyme EC 2.7.1.128 Is a reactant or product of enzyme EC 2.7.1.129 Is a reactant or product of enzyme EC 2.7.1.130 Is a reactant or product of enzyme EC 2.7.1.131 Is a reactant or product of enzyme EC 2.7.1.132 Is a reactant or product of enzyme EC 2.7.1.134 Is a reactant or product of enzyme EC 2.7.1.135 Is a reactant or product of enzyme EC 2.7.1.136 Is a reactant or product of enzyme EC 2.7.1.137 Is a reactant or product of enzyme EC 2.7.1.138 Is a reactant or product of enzyme EC 2.7.1.140 Is a reactant or product of enzyme EC 2.7.1.141 Is a reactant or product of enzyme EC 2.7.1.144 Is a reactant or product of enzyme EC 2.7.1.145 Is a reactant or product of enzyme EC 2.7.1.146 Is a reactant or product of enzyme EC 2.7.1.147 Is a reactant or product of enzyme EC 2.7.1.148 Is a reactant or product of enzyme EC 2.7.1.149 Is a reactant or product of enzyme EC 2.7.1.150 Is a reactant or product of enzyme EC 2.7.1.151 Is a reactant or product of enzyme EC 2.7.1.153 Is a reactant or product of enzyme EC 2.7.1.154 Is a reactant or product of enzyme EC 2.7.1.156 Is a reactant or product of enzyme EC 2.7.1.- Is a reactant or product of enzyme EC 2.7.2.1 Is a reactant or product of enzyme EC 2.7.2.2 Is a reactant or product of enzyme EC 2.7.2.3 Is a reactant or product of enzyme EC 2.7.2.4 Is a reactant or product of enzyme EC 2.7.2.6 Is a reactant or product of enzyme EC 2.7.2.7 Is a reactant or product of enzyme EC 2.7.2.8 Is a reactant or product of enzyme EC 2.7.2.11 Is a reactant or product of enzyme EC 2.7.2.13 Is a reactant or product of enzyme EC 2.7.2.14 Is a reactant or product of enzyme EC 2.7.2.- Is a reactant or product of enzyme EC 2.7.3.1 Is a reactant or product of enzyme EC 2.7.3.2 Is a reactant or product of enzyme EC 2.7.3.3 Is a reactant or product of enzyme EC 2.7.3.4 Is a reactant or product of enzyme EC 2.7.3.5 Is a reactant or product of enzyme EC 2.7.3.6 Is a reactant or product of enzyme EC 2.7.3.7 Is a reactant or product of enzyme EC 2.7.3.8 Is a reactant or product of enzyme EC 2.7.3.10 Is a reactant or product of enzyme EC 2.7.3.11 Is a reactant or product of enzyme EC 2.7.3.12 Is a reactant or product of enzyme EC 2.7.4.1 Is a reactant or product of enzyme EC 2.7.4.2 Is a reactant or product of enzyme EC 2.7.4.3 Is a reactant or product of enzyme EC 2.7.4.4 Is a reactant or product of enzyme EC 2.7.4.6 Is a reactant or product of enzyme EC 2.7.4.7 Is a reactant or product of enzyme EC 2.7.4.8 Is a reactant or product of enzyme EC 2.7.4.9 Is a reactant or product of enzyme EC 2.7.4.10 Is a reactant or product of enzyme EC 2.7.4.11 Is a reactant or product of enzyme EC 2.7.4.12 Is a reactant or product of enzyme EC 2.7.4.13 Is a reactant or product of enzyme EC 2.7.4.14 Is a reactant or product of enzyme EC 2.7.4.15 Is a reactant or product of enzyme EC 2.7.4.16 Is a reactant or product of enzyme EC 2.7.4.18 Is a reactant or product of enzyme EC 2.7.4.19 Is a reactant or product of enzyme EC 2.7.4.21 Is a reactant or product of enzyme EC 2.7.6.2 Is a reactant or product of enzyme EC 2.7.7.5 Is a reactant or product of enzyme EC 2.7.7.8 Is a reactant or product of enzyme EC 2.7.7.35 Is a reactant or product of enzyme EC 2.7.7.36 Is a reactant or product of enzyme EC 2.7.7.53 Is a reactant or product of enzyme EC 2.7.-.- Is a reactant or product of enzyme EC 3.1.2.4 Is a reactant or product of enzyme EC 3.1.2.18 Is a reactant or product of enzyme EC 3.1.2.19 Is a reactant or product of enzyme EC 3.5.2.9 Is a reactant or product of enzyme EC 3.5.2.14 Is a reactant or product of enzyme EC 3.5.4.7 Is a reactant or product of enzyme EC 3.5.4.9 Is a reactant or product of enzyme EC 3.6.1.3 Is a reactant or product of enzyme EC 3.6.1.5 Is a reactant or product of enzyme EC 3.6.1.8 Is a reactant or product of enzyme EC 3.6.1.15 Is a reactant or product of enzyme EC 3.6.1.29 Is a reactant or product of enzyme EC 3.6.1.41 Is a reactant or product of enzyme EC 3.6.1.- Is a reactant or product of enzyme EC 3.6.3.1 Is a reactant or product of enzyme EC 3.6.3.6 Is a reactant or product of enzyme EC 3.6.3.8 Is a reactant or product of enzyme EC 3.6.3.9 Is a reactant or product of enzyme EC 3.6.3.10 Is a reactant or product of enzyme EC 3.6.3.14 Is a reactant or product of enzyme EC 3.6.3.15 Is a reactant or product of enzyme EC 3.6.3.46 Is a reactant or product of enzyme EC 3.6.3.49 Is a reactant or product of enzyme EC 3.6.3.50 Is a reactant or product of enzyme EC 3.6.3.51 Is a reactant or product of enzyme EC 3.6.3.52 Is a reactant or product of enzyme EC 3.6.4.1 Is a reactant or product of enzyme EC 3.6.4.2 Is a reactant or product of enzyme EC 3.6.4.3 Is a reactant or product of enzyme EC 3.6.4.4 Is a reactant or product of enzyme EC 3.6.4.5 Is a reactant or product of enzyme EC 3.6.4.6 Is a reactant or product of enzyme EC 3.6.4.7 Is a reactant or product of enzyme EC 3.6.4.8 Is a reactant or product of enzyme EC 3.6.4.9 Is a reactant or product of enzyme EC 3.6.4.10 Is a reactant or product of enzyme EC 3.6.4.11 Is a reactant or product of enzyme EC 4.1.1.33 Is a reactant or product of enzyme EC 4.1.1.49 Is a reactant or product of enzyme EC 4.2.1.93 Is a reactant or product of enzyme EC 4.6.1.- Is a reactant or product of enzyme EC 6.2.1.5 Is a reactant or product of enzyme EC 6.2.1.6 Is a reactant or product of enzyme EC 6.2.1.9 Is a reactant or product of enzyme EC 6.2.1.13 Is a reactant or product of enzyme EC 6.2.1.18 Is a reactant or product of enzyme EC 6.2.1.- Is a reactant or product of enzyme EC 6.3.1.2 Is a reactant or product of enzyme EC 6.3.1.4 Is a reactant or product of enzyme EC 6.3.1.6 Is a reactant or product of enzyme EC 6.3.1.8 Is a reactant or product of enzyme EC 6.3.1.9 Is a reactant or product of enzyme EC 6.3.1.10 Is a reactant or product of enzyme EC 6.3.1.- Is a reactant or product of enzyme EC 6.3.2.2 Is a reactant or product of enzyme EC 6.3.2.3 Is a reactant or product of enzyme EC 6.3.2.4 Is a reactant or product of enzyme EC 6.3.2.5 Is a reactant or product of enzyme EC 6.3.2.6 Is a reactant or product of enzyme EC 6.3.2.7 Is a reactant or product of enzyme EC 6.3.2.8 Is a reactant or product of enzyme EC 6.3.2.9 Is a reactant or product of enzyme EC 6.3.2.10 Is a reactant or product of enzyme EC 6.3.2.12 Is a reactant or product of enzyme EC 6.3.2.13 Is a reactant or product of enzyme EC 6.3.2.14 Is a reactant or product of enzyme EC 6.3.2.16 Is a reactant or product of enzyme EC 6.3.2.17 Is a reactant or product of enzyme EC 6.3.2.18 Is a reactant or product of enzyme EC 6.3.2.20 Is a reactant or product of enzyme EC 6.3.2.22 Is a reactant or product of enzyme EC 6.3.2.23 Is a reactant or product of enzyme EC 6.3.2.25 Is a reactant or product of enzyme EC 6.3.2.27 Is a reactant or product of enzyme EC 6.3.3.1 Is a reactant or product of enzyme EC 6.3.3.2 Is a reactant or product of enzyme EC 6.3.3.3 Is a reactant or product of enzyme EC 6.3.4.2 Is a reactant or product of enzyme EC 6.3.4.3 Is a reactant or product of enzyme EC 6.3.4.6 Is a reactant or product of enzyme EC 6.3.4.7 Is a reactant or product of enzyme EC 6.3.4.8 Is a reactant or product of enzyme EC 6.3.4.12 Is a reactant or product of enzyme EC 6.3.4.13 Is a reactant or product of enzyme EC 6.3.4.14 Is a reactant or product of enzyme EC 6.3.4.16 Is a reactant or product of enzyme EC 6.3.4.17 Is a reactant or product of enzyme EC 6.3.4.- Is a reactant or product of enzyme EC 6.3.5.3 Is a reactant or product of enzyme EC 6.3.5.5 Is a reactant or product of enzyme EC 6.3.5.6 Is a reactant or product of enzyme EC 6.3.5.7 Is a reactant or product of enzyme EC 6.3.5.9 Is a reactant or product of enzyme EC 6.3.5.10 Is a reactant or product of enzyme EC 6.4.1.1 Is a reactant or product of enzyme EC 6.4.1.2 Is a reactant or product of enzyme EC 6.4.1.3 Is a reactant or product of enzyme EC 6.4.1.4 Is a reactant or product of enzyme EC 6.4.1.5 Is a reactant or product of enzyme EC 6.6.1.1 Is a reactant or product of enzyme EC 6.6.1.2 > 20398-34-9 ADP Adenosine 5'-diphosphate C00008 > 20398-34-9 > C00008 > 229993 230242 230243 230264 230462 230463 230658 230659 230660 230661 230662 230780 230781 230790 230801 230908 230909 230934 231058 231091 349816 349817 349839 349840 442639 442640 442945 442946 442947 442948 443144 443259 443260 443261 443262 443263 443264 443271 443272 443273 443282 443284 443438 493790 493809 493810 493956 493957 494043 494047 494379 494380 494553 494554 494560 494561 494741 494742 494821 494822 494831 494832 515218 515219 515220 515221 515222 515256 576003 576004 576052 576053 576073 576074 576075 576076 576125 576126 576127 576128 576129 576130 576200 576201 576202 576239 576240 576241 576320 640324 640325 640326 640327 640329 640330 640331 640332 640333 640334 809209 809241 809310 999572 999853 999854 1064980 1065085 1065086 1065087 1065088 1065227 1065285 1065286 1065329 1065359 1065360 1065369 1065372 1065373 1065374 1127198 1127199 1127205 1127264 1310775 1310776 1310777 1310778 1310978 1310979 1310980 1310981 1311096 1311097 1311179 1311190 1311281 1311287 1311288 1311289 1311290 1311291 1311292 1311313 1311314 1311315 1311316 1311317 1311318 1311319 1311382 1311383 1311384 1311385 1311409 1311410 1311411 1311412 1311413 1421234 1421235 1421238 1421242 1421243 1421443 1421465 1421466 1421467 1421468 1421609 1421610 1421611 1421612 1421613 1421614 1421658 1421659 1633050 1633051 1633052 1633053 1633150 1633151 1633152 1633153 1633219 1633394 1633419 1633420 1633421 1633422 1633423 1633424 1633462 1633463 1633467 1633520 1633542 1827621 1827741 1827931 1941986 1941987 1942061 1942062 1942063 1942064 1942065 1942079 1942080 1942106 1942107 1942130 1942131 1942280 1942281 1942473 1942474 1942475 1942476 1942527 1942693 1942708 1942709 1942710 1942711 1942717 1942718 1942719 1942720 1942749 1942960 1942964 1942965 1943031 1943032 1943033 1943034 1943490 1943494 1943495 1943496 1943515 1943516 1943517 1943528 1943539 1943540 1943551 1943552 1943553 1943554 2098340 2098341 2098342 2098345 2098346 2098375 2098376 2098377 2098378 2098399 2098400 2098401 2098402 2098410 2098411 2098412 2098413 2098418 2098419 2194091 2194103 2194104 2392190 2392191 2392237 2392238 2392239 2392240 2392334 2392335 2392337 2392444 2392445 2392446 2392565 2392566 2392581 2392647 2392648 2392649 2392650 2392651 2392698 2392699 2392719 2554681 2554754 2554755 2554778 2554779 2624429 2624430 2624431 2624432 2624433 2624434 2624435 2624436 2624499 2624566 2624567 2624585 2624601 2624649 2624651 2624653 2624693 2780855 2780856 2780916 2781023 2781024 2781025 2781026 2781151 2781311 2781312 2914218 2914219 2914220 2914221 2914222 2914223 2914224 2914234 2914235 2914236 2914237 2914238 2914239 2914240 2914260 2914261 2914262 2914263 2914264 2914265 2914266 2914271 2914272 2914273 2914311 2914312 2914313 2914314 2914315 2914316 2914317 2914342 2914343 2914344 2914345 2914378 2914581 2914582 2914653 2914654 2914655 2914656 2914663 2981777 2981818 2981911 2981912 2981913 2981914 2981915 2981916 2981917 2981919 2981920 2981921 2981922 2981923 2981924 2981925 2981928 2981929 2981930 2981931 2981932 2981933 2981934 2981958 2981959 2981960 2981961 2981962 2981963 2981964 2981965 2981966 2981967 2981974 2982011 2982012 2982072 2982073 2982086 2982122 2982123 2982124 3114379 3114380 3114385 3114386 3114421 3114422 3114436 3114437 3114438 3114439 3114440 3114441 3114442 3114446 3114447 3114448 3114449 3114450 3114451 3114452 3114453 3114520 3114521 3114524 3114534 3114535 3114541 3114542 3114543 3212328 3212329 3212330 3212331 3212553 3212554 3212623 3212729 3212820 3212828 3318670 3318671 3318685 3318686 3318687 3318724 3318725 3318728 3318746 3318747 3318768 3318769 3318791 3318817 3318818 3318819 3318820 3318821 3318822 3318823 3318824 3318825 3318826 3318827 3318828 3318829 3318830 3318831 3318832 3318847 3318848 3318851 3318852 3318871 3318895 3319009 3319075 3319076 3402101 3402102 3659945 3659946 3659947 3659948 3659949 3659950 3659951 3659952 3660219 3660220 3660221 3660222 3660261 3660262 3660263 3660264 3660265 3660266 3660267 3660268 3660274 3660290 3660291 3660292 3745771 3745772 3891308 3891309 3891376 3891430 3891431 3891434 3891548 3891564 3891565 3891570 3891571 3891582 3891583 3891613 3891614 3891686 3891687 3891688 3891689 3891720 3891722 3891724 3891726 3891728 3891730 3891948 3891949 3891953 3891993 3892005 4139569 4139570 4139633 4139634 4139729 4139730 4139731 4139732 4139733 4139734 4139832 4139833 4139834 4139835 4139840 4139841 4139842 4139843 4139900 4139965 4139966 4139970 4139971 4140014 4140015 4140019 4140020 4140021 4140022 4140023 4140024 4388862 4388863 4388864 4388865 4388866 4388867 4389105 4389106 4389108 4389109 4389155 4389156 4389210 4389211 4389212 4389213 4389215 4389227 4389228 4389237 4389238 4389239 4389249 4389250 4389291 4389292 4389317 4389318 4389319 4389449 4389450 4557921 4557922 4557923 4557924 4557925 4557926 4557927 4557928 4558116 4558117 4558118 4558119 4558120 4558121 4558131 4558132 4558189 4558190 4558226 4558227 4558228 4558229 4558230 4558231 4558232 4558233 4558234 4558235 4558236 4558237 4558256 4558257 4699532 4699586 4699624 4699874 4699875 4929839 4929840 4929841 4929842 4929843 4929844 4929845 4929846 4929927 4929929 4929930 4929931 4929932 4929935 4929936 4929937 4929938 4929939 4929940 4929941 4929942 4930039 4930156 4930157 4930173 4930213 5107421 5107491 5107510 5107511 5107526 5107527 5107582 5107583 5107584 5107585 5107601 5107602 5542068 5542069 5542070 5542071 5542072 5542074 5542075 5542076 5542077 5542078 5542079 5542080 5542081 5542091 5542092 5542093 5542094 5542095 5542096 5542103 5542104 5542141 5542142 5542146 5542439 5542519 5821946 5821947 5821948 5821949 5821950 5821951 5821976 5821977 5821978 5821979 5821980 5821981 5821982 5821983 5822263 5822278 5822279 5822393 5822394 5822395 5822396 5822495 5822496 5822497 5822498 5822499 5822578 6137337 6137338 6137339 6137340 6137441 6137462 6137471 6137568 6137569 6137732 6137733 6435531 6435532 6435533 6435534 6435535 6435536 6435537 6435538 6435671 6435729 6435742 6435816 6435822 6573489 6573490 6573491 6573492 6573639 6573640 6573676 6573677 6573678 6573679 6729730 6729731 6729732 6729776 6729803 6729828 6729847 6729850 6729892 6729893 6729902 6729903 6729904 6729905 6729954 6729955 6729992 6729993 6730014 6730116 6730117 6730118 6730119 6730120 6730121 6730122 6730123 6730126 6730127 6730128 6730129 6730130 6730131 6730132 6730133 6730187 6730188 6730189 6730190 6730191 6730192 6730193 6730194 6730455 6730456 6730463 6730486 6980398 6980399 6980400 6980401 6980643 6980644 6980727 6980728 6980729 6980730 6980731 6980732 6980733 6980734 6980894 7245352 7245424 7245651 7245652 7245663 7245664 7245830 7245831 7546569 7546574 7766821 7766822 7766859 7766860 7766861 7766862 7767026 7767027 7767097 7767098 7767133 7767134 7767135 7767136 7767137 7767138 7767139 7767140 7767148 7767149 8569365 8569366 8569440 8569441 8569477 8569478 8569508 8569509 9256854 9256855 9256856 9256857 9256858 9256859 9256961 9256962 9256963 9256964 9256965 9256966 9256967 9256968 9256969 9256970 9256971 9256972 9257011 9257012 9257013 9257014 9257015 9257016 9257017 9257018 9257019 9257020 9257123 9257124 9257125 9257126 9257128 9955004 9955156 9955157 9955318 9955319 9955320 9955367 9955368 9955369 9955370 9955371 9955372 9955373 9955374 10120800 10120801 10120853 10120854 10120871 10120872 10120992 10120993 10120994 10120995 10121009 10121010 10121011 10121012 10121013 10121014 10121071 10121072 10121073 10121074 10835679 10835680 10835681 10835682 10835731 10835732 10835829 10835830 10835831 10835834 10835835 10835836 11513296 11513657 11513658 11513659 11513660 11513667 11513668 11513669 11513670 11513943 11513944 11513946 11513947 11513949 11513950 11514023 11514054 12084262 12084263 12084384 12084385 12084386 12084387 12084388 12084389 12084390 12084391 12084791 13096153 13096247 13096248 13096249 13096250 13096251 13096252 13096253 13096254 13096255 13096256 13096257 13096258 13096259 13096260 13096261 13096262 13096263 13096264 13096265 13096266 13096294 13096295 13096296 13096297 13096382 13096383 13096424 13096425 13096498 13096555 13096556 13096557 13096558 13096582 13096583 13096584 13096585 13096586 13096719 13096720 13096721 13096722 13096723 13096724 13096755 13096756 13096757 13096758 13096759 13096760 13096761 13096762 13096763 13096764 13399500 13399612 13399644 13399857 13399858 13399902 13399903 13786640 13786641 13786642 13786643 13786644 13786645 13786646 13786647 13786648 13786649 13786650 13786651 13786668 13786669 13786670 13786671 13786672 13786673 13786674 13786675 13786676 13786677 13786678 13786679 13786784 13786785 13786786 13786787 13786936 13786942 13787040 13787041 13787042 14277876 14277877 14277914 14277915 14277916 14277917 14277958 14277959 14277960 14277961 14277962 14277963 14277964 14277965 14277966 14277967 14277968 14277969 14277970 14277971 14277972 14277973 14278239 14278287 14278288 14278354 14278355 14278498 14278499 14488434 14488435 14488436 14488437 14488515 14488516 14488517 14488518 14488519 14488520 14488646 14488651 14488652 14488653 14488656 14488657 14488739 14488796 14488797 14488798 14488799 14488800 14719567 14719578 14719579 14719632 14719633 14719681 14719682 14719777 15825694 15825695 15825812 15825814 15825815 15825816 15825817 15825990 15825991 15826113 15826569 15826570 15826589 15826590 15826591 15826592 15826771 15826772 15826826 15987970 15987971 15987972 15987973 15987974 15987975 15987976 15987977 15987978 15987979 15987980 15987981 15987982 15987983 15987984 15987985 15988007 15988008 15988009 15988010 15988011 15988250 15988251 15988306 15988307 15988332 15988333 15988334 15988335 15988336 15988337 15988338 15988339 15988342 15988343 15988344 15988345 15988346 15988347 15988387 15988388 15988389 15988455 16974935 16974936 16975072 16975130 16975131 16975219 16975313 16975314 16975315 16975316 16975317 16975318 16975319 16975320 16975321 16975322 16975323 16975360 16975361 16975362 16975363 17942837 17942838 17942839 17942840 17942879 17942987 17943043 17943044 17943105 17943106 17943107 17943108 17943109 17943110 17943111 17943112 17943325 18158777 18158778 18158854 18158903 18158904 18158905 18158906 18158907 18158908 18158909 18158910 18158988 18158989 18159010 18655410 18655411 18655412 18655420 18655421 18655422 18655423 18655472 18655515 18655523 18655524 18655525 18655526 18655527 18655528 18655529 18655530 18655536 18655537 18655538 18655539 18655578 18655579 18655580 18655581 18655777 18655778 18655779 18655780 18655781 18655782 18655783 18655784 20149891 20149899 20149900 20150422 20150423 20150571 20150572 20150573 20150574 20150577 20150578 20150579 20150580 20150729 20150730 20150731 20150732 20150733 20150734 20150886 20151029 20151052 20151053 20151083 20151205 20151206 20151213 20151214 20663854 20663909 20663951 20663952 20663953 20663967 20663968 20663969 20663970 20663971 20663972 20664077 20664078 20664283 20664284 21465503 21465504 21465693 21465694 21465698 21465772 21465773 21465774 21465775 21465776 21465777 21465779 21465780 21465781 21465782 21465783 21465784 21465788 21465789 21465819 21465820 21465821 21465822 21465823 21465827 21465828 21465829 21465830 21465831 21465832 21465833 21465834 21465883 21465884 21465885 21465886 21465887 21465888 21465889 21465890 21465891 21465892 21465893 21465894 21466089 21466090 21466091 21466135 21466137 21466141 21730412 21730413 21730588 21730589 21730590 21730591 21730592 21730593 21730594 21730595 21730653 21730654 21730689 21730690 21730738 21730903 21730904 21730905 21730906 21730907 21730908 21730909 21730910 21730911 21730912 21730913 21730914 22218646 22218698 22218699 22218700 22218701 22218702 22218703 22218713 22218714 22218715 22218716 22218717 22218718 22218719 22218720 22218721 22218722 22218723 22218724 22218725 22218726 22218727 22218728 22218729 22218730 22218731 22218732 22218733 22218734 22218735 22218736 22218737 22218738 22218739 22218740 22218741 22218742 22218743 22218744 22218745 22218746 22218747 22218748 22218749 22218750 22218751 22218752 22218753 22218754 22218755 22218756 22218757 22218758 22218759 22218760 22218786 22218787 22219037 22219316 22219397 22219398 22219401 22219402 22219403 22219404 22219405 22219406 22219407 22219408 23200290 23200291 23200417 23200418 24158608 24158845 24158846 24158847 24158848 24158849 24158850 24158851 24158852 24158853 24158854 24158855 24158856 24158857 24158858 24158859 24158860 24158900 24158918 24158919 24158920 24158921 24158922 24158923 24158924 24158925 24158942 24158943 24159070 24159071 24159112 24159113 24987247 24987248 24987249 24987250 24987353 24987354 24987355 24987356 24987359 24987360 24987361 24987362 24987363 24987384 24987410 24987411 24987412 24987619 24987639 24987739 24987740 24987885 24987886 27064988 27064989 27064990 27064991 27065119 27065120 27065452 27065453 27065454 27065458 27065506 27065600 27065601 27065602 27065603 27065605 27065606 27065607 27065608 27065790 27065791 27065792 27065793 27066378 27066379 27066381 27066382 27573692 27573693 27573759 27573800 27573834 27573835 27573836 27573837 27573856 27573857 27573982 27573983 27573984 27573985 27573986 27573987 27573988 27573989 27574165 27574166 28373496 28373614 28373615 28373781 28373782 28373853 28373854 28373855 28374107 28948416 28948417 28948482 28948483 28948484 28948485 28948540 28948541 28948542 28948543 28948544 28948545 28948546 28948547 28948548 28948549 28948550 28948551 28948552 28948553 28948554 28948555 28948556 28948557 28948558 28948559 28948560 28948561 28948562 28948563 28948564 28948565 28948566 28948567 28948568 28948569 28948570 28948571 28948694 28948695 28948696 28948697 28948698 28948699 28948700 28948772 28948773 28948774 29726284 29726285 29726286 29726287 29726471 29726472 29726473 29726528 29726529 29726587 29726597 29726714 29726715 29726716 29726717 29726718 29726719 29726720 29726919 29726920 30749342 30749343 30749344 30749345 30749346 30749347 30749348 30749349 30749350 30749351 30749352 30749353 30749431 30749432 30749433 30749563 30749564 30749565 30749566 30749567 30749568 30749604 30749799 30749800 30749801 30749802 30749803 30749804 30749873 30749874 30749875 30749876 30749877 30749932 30749933 30749934 30749935 30749936 30750130 30750131 30750140 31615467 31615468 31615469 31615470 31615471 31615472 31615591 31615810 31615811 31615812 31615910 31615911 31615912 31615913 31615914 31615915 31615916 31615917 31615984 33356936 33356937 33356938 33356939 33356961 33356977 33356978 33356998 33356999 33357000 33357001 33357002 33357003 33357004 33357005 33357006 33357007 33357008 33357009 33357010 33357011 33357307 33357308 33357309 33357513 33357514 33357753 33357754 33357757 33357776 33357777 33357778 33357779 33357863 33357864 33357874 33357875 33357876 33357877 33357878 33358114 33358115 33358116 33358117 33358120 33358180 33358197 33358198 34809625 34809626 34809858 34809859 34809861 34809862 34809868 34809869 34809870 34810054 34810055 34810056 34810057 34810065 34810066 34810067 34810081 34810082 34810211 34810519 34810520 34810521 34810522 34810567 34810568 34810589 34810590 34810606 34810607 34810913 34810914 34810915 34810932 34810933 34810934 34811267 34811348 34811400 34811495 34811496 34811497 34811498 34811649 34811650 34811713 37926794 37926795 37926796 37926797 37926803 37926807 37926808 37926890 37926891 37927282 37927357 37927469 37927502 37927861 37927862 37927864 37927865 37928127 37928137 37928159 37928160 37928161 38492608 38492609 38492610 38492611 38492658 38492659 38492660 38492661 38492688 38492689 38492690 38492691 38492692 38492693 38492694 38492695 38492696 38492697 38492698 38492699 38492700 38492701 38492702 38492703 38492740 38492741 38492742 38492743 38492744 38492745 38492746 38492747 38492748 38492749 38492750 38492751 38492753 38492754 38492874 38492875 38492892 38492893 38492894 38492895 38492896 38492897 38492899 38492900 38493067 38493068 38493069 38493070 39654046 39654047 39654456 39654756 39654757 39654758 39654759 39654760 39655044 40889048 40889049 40889054 40889055 40889056 40889057 40889209 40889210 40889211 40889212 40889213 40889214 40889215 40889216 40889217 40889218 40889219 40889220 40889221 40889222 40889223 40889224 40889225 40889226 40889227 40889228 40889229 40889230 40889231 40889232 40889233 40889234 40889235 40889236 40889309 40889422 40889423 40889424 40889425 40889426 40889427 40889446 40889699 40889700 40889701 40889702 40889703 40889704 40889712 40889713 40889714 40889715 40889881 40889882 40889941 40889942 40889943 40889952 40889953 40889954 40889995 40889996 40889997 40889998 40889999 40890000 40890012 40890021 40890022 40890023 42543246 42543283 42543284 42543285 42543286 42543287 42543288 42543289 42543290 42543295 42543296 42543350 42543351 42543352 42543353 42543361 42543362 42543363 42543364 42543365 42543366 42543367 42543368 42543369 42543370 42543371 42543372 42543373 42543374 42543375 42543376 42543472 42543473 42543503 42543504 42543505 42543506 42543507 42543565 42543699 42543881 42543904 46014981 46014982 46014983 46014984 46014985 46014986 46014987 46014988 46014989 46014990 46014991 46014992 46014993 46014994 46014995 46014996 46014997 46014998 46014999 46015000 46015001 46015002 46015003 46015004 46015005 46015006 46015007 46015030 46015370 46015454 46015457 46015458 46015459 46015523 46015542 46015750 46015751 46015797 46015820 47168572 47168786 47168787 47168887 47168960 47168961 47168962 47168963 47169015 47169016 47169017 47169018 47169019 47169020 47169021 47169022 47169023 47169244 47169285 47169286 47169287 47169288 47169307 47169340 47169341 47169342 47169343 47169395 47169396 47169397 47169398 47169399 47169400 47169401 47169402 47169403 47169404 47169405 47169424 47169425 47169448 47169449 48425192 48425293 48425310 48425311 48425314 48425315 48425316 48425317 48425318 48425319 48425320 48425321 48425322 48425323 48425324 48425325 48425326 48425327 48425328 48425401 48425402 48425403 48425544 48425583 48425584 48425585 48425586 48425587 48425588 48425717 48425784 48425785 48425786 48425787 48425788 48425789 48425790 48425791 48425792 48425793 48425799 48425800 48425837 48425885 49258343 49258344 49258467 49258468 49258469 49258470 49258494 49258756 49258971 49258972 49258973 49258974 49258975 49259182 49259183 49259229 49259230 49259231 49259316 49259331 49259332 49259333 49259334 49259391 49259392 49259449 49259486 49259562 50513424 50513425 50513587 50513588 50513600 50513700 50513701 50513708 50513709 50513735 50513737 50513738 50513739 50513740 50513741 50513742 50513743 50513744 50513745 50513746 50513748 50513749 50513750 50513751 50513752 50513753 50513784 50513785 50513992 50513993 50514017 50514018 50514019 50514020 50514021 50514024 50514075 50514076 51247099 51247100 51247101 51247102 51247103 51247104 51247105 51247106 51247107 51247108 51247109 51247110 51247135 51247136 51247205 51247222 51247223 51247250 51247251 51247290 51247346 51247402 51247403 51247418 51247419 51247420 51247421 51247460 51247551 51247552 51247626 51247627 51247866 51247867 51247868 51247969 51247970 51247971 51247972 51247973 51247974 51247975 51247976 51247977 51247978 51247979 51247980 51247981 51247982 52695345 52695346 52695416 52695417 52695418 52695419 52695433 52695434 52695435 52695436 52695451 52695452 52695523 52695524 52695525 52695526 52695527 52695528 52695575 52695576 52695577 52695578 52695960 52695961 52695962 52695963 52695966 52695967 52695995 52695996 52695997 52695998 52696004 52696005 52696010 52696045 52696047 52696104 52696105 52696106 52696121 52696133 52696134 52696260 52696261 55669667 55669668 55669669 55669670 55669671 55669672 55669673 55669674 55669675 55669676 55669677 55669678 55669679 55669680 55669760 55669761 55669762 55669763 55669821 55669822 55669823 55669824 55669825 55669826 55669827 55669828 55669841 55670081 55670082 55670153 55670154 55670331 55670332 55670333 55670334 55670356 55670357 55670358 55670359 55670402 55670403 55670404 55670405 55670416 55670417 55670426 55670460 55670461 55670489 55670575 55670576 55670577 55670734 55670735 55670736 55670737 55670738 56553615 56553624 56553625 56553644 56553645 56554050 56554051 56554060 56554061 56554062 56554063 56554162 56554232 56554233 56554234 56554235 56554236 56554237 56554363 56554364 56554365 56554366 56554367 56554368 56554454 56554455 56554456 56554463 56554566 56554567 56554568 56554569 56554570 56554571 56554725 56554726 56965987 56965988 56965989 56965990 56965991 56965992 56965993 56965994 56965995 56965996 56965997 56965998 56966000 56966001 56966002 56966012 56966013 56966213 56966214 56966215 56966216 56966217 56966218 56966219 56966220 56966221 56966222 56966223 56966225 56966226 56966227 56966228 56966229 56966230 56966612 56966613 56966614 56966615 56966616 56966617 56966856 56966875 56967138 56967139 56967140 56967141 56967142 56967143 56967174 56967175 56967176 56967177 56967178 56967179 56967180 56967181 56967182 56967183 56967184 56967185 56967186 56967187 56967188 56967189 56967222 56967223 56967239 56967283 58176848 58176878 58176879 58176880 58176911 58176912 58176913 58176914 58177056 58177057 58177058 58177059 58177184 58177185 58177238 58177239 58177240 58177241 58177292 58177293 58177294 58177295 58177296 58177297 58177298 58177299 58177366 58177447 58177448 58177449 58177450 58177547 60593446 60593465 60593466 60593467 60593468 60593469 60593470 60593548 60593549 60593551 60593552 60593733 60593734 60593775 60593791 60593792 60593793 60593794 60593823 60593826 60593827 60593828 60593867 60593882 60593908 60593909 60593910 60593911 60593912 60593913 60594102 60594103 60594104 60594105 60594373 60594374 60594375 60594475 60594476 61679618 61679619 61679782 61679783 61679784 61679785 61679786 61679787 61679788 61679789 61679790 61679791 61679792 61679793 61680034 61680035 61680155 61680156 61680157 61680158 61680159 61680160 61680161 61680162 61680167 61680168 61680173 61680174 61680175 61680176 61680193 61680194 61680370 61680371 61680372 61680373 61680374 61680375 61680404 61680405 61680547 61680548 61680624 61680625 61680730 61680889 61680890 61680891 61680895 62737945 62737992 62737993 62737994 62737995 62737996 62737997 62738130 62738131 62738152 62738153 62738154 62738155 62738156 62738157 62738177 62738384 62738385 62738401 62738402 62738403 62738404 62738505 62738506 62738645 62738646 62738647 62738648 62738649 62738650 62738651 62738652 62738653 62738751 62738752 62738753 62738754 62738911 62738958 62738959 62739016 62739017 62739018 62739019 62739020 62739021 66360233 66360234 66360235 66360236 66360237 66360238 66360239 66360240 66360241 66360242 66360243 66360244 66360309 66360310 66361120 66361141 66361219 66361235 66361238 66361239 66361240 66361241 66361242 66361243 66361246 66361251 66361252 66361253 66361279 66361280 66361281 66361282 66361285 66361286 66361289 66361290 66361291 66361292 66361317 66361318 66361358 66361359 66361360 66361367 66361407 66361544 66361545 66361546 66361547 66361548 66361549 66361550 66361551 66361552 66361553 66361575 66361576 66361579 66361580 66361773 66361774 67463838 67463839 67463840 67463893 67463894 67463897 67463898 67463899 67463900 67463908 67463909 67463918 67463976 67464020 67464021 67464022 67464023 67464024 67464025 67464026 67464027 67464135 67464136 67464173 67464380 67464392 67464401 67464402 67464403 67464404 67464423 67464428 67464429 67464430 67464431 67464432 67464433 67464490 67464491 67464618 71041770 71041879 71041942 71041945 71041946 71041947 71041948 71041981 71041982 71041983 71042030 71042031 71042032 71042033 71042057 71042058 71042059 71042060 71042061 71042461 71042462 71042463 71042541 71042542 71042543 71042544 71042545 71042546 71042556 71042557 71042558 71042559 71042560 71042561 71042562 71042563 71042564 71042565 71042798 71042799 73535278 73535279 73535280 73535281 73535366 73535399 73535400 73535489 73535682 73535726 73535727 73536172 73536173 73536195 73536196 73536291 73536292 73536296 73536297 73536298 73536299 73536300 73536301 73536302 73536303 73536318 73536319 73536320 73536321 73536322 73536323 75766453 75766454 > 46015455 46015524 46015543 > http://www.genome.jp/kegg/kegg2.html > http://www.genome.jp/dbget-bin/www_bget?cpd+C00008 > 6022 1 > 1 12 8 1 13 8 10 15 5 2 14 8 2 15 8 7 3 5 4 14 8 4 5 8 4 6 8 5 12 8 6 13 8 6 15 8 8 16 6 9 17 6 $$$$