1051 -OEChem-02210611492D 26 26 0 0 0 0 0 0 0999 V2000 2.5369 -1.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1350 -1.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0010 0.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2690 1.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4030 -1.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1350 -0.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2690 0.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4030 -0.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2690 -1.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.5369 0.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5991 0.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2331 -0.6160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4030 1.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2331 1.1160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8671 -0.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7331 0.2500 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 2.2269 -1.2131 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 -2.0600 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8469 -2.2869 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6719 -1.5600 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3996 0.7249 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6025 0.7249 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8059 1.5600 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 -0.0600 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1360 0.4400 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9231 -1.1530 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 5 1 0 0 0 0 1 17 1 0 0 0 0 1 18 1 0 0 0 0 1 19 1 0 0 0 0 2 6 2 0 0 0 0 2 9 1 0 0 0 0 2 20 1 0 0 0 0 3 6 1 0 0 0 0 3 15 1 0 0 0 0 3 21 1 0 0 0 0 3 22 1 0 0 0 0 4 7 1 0 0 0 0 4 13 2 0 0 0 0 4 23 1 0 0 0 0 5 8 1 0 0 0 0 5 9 2 0 0 0 0 6 7 1 0 0 0 0 7 8 2 0 0 0 0 8 10 1 0 0 0 0 10 24 1 0 0 0 0 11 16 1 0 0 0 0 11 25 1 0 0 0 0 12 16 1 0 0 0 0 12 26 1 0 0 0 0 14 16 2 0 0 0 0 15 16 1 0 0 0 0 M END > 1 > 1051 > 7 > 3 > 4 > AAADcQI4csAAAAAAAAAAAAAAAAAAAAAAACwAAAAAAAABAAAAHgAAgCAIAADhDAwAhi4GnhATCJJ3HEOogIKExCBgNSA9IdgAJgrYTJOV0nZmSHGE2dgR4ANQ/gcAAIAOAAAAAAAAAAAAAAAAAAAAAAAAAA== > (4-formyl-5-hydroxy-6-methyl-3-pyridyl)methoxyphosphonic acid > (4-formyl-5-hydroxy-6-methyl-3-pyridyl)methoxyphosphonic acid > (4-formyl-5-hydroxy-6-methyl-pyridin-3-yl)methoxyphosphonic acid > (5-hydroxy-4-methanoyl-6-methyl-pyridin-3-yl)methoxyphosphonic acid > (4-formyl-5-hydroxy-6-methyl-3-pyridyl)methoxyphosphonic acid > InChI=1/C8H10NO6P/c1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14/h2-3,11H,4H2,1H3,(H2,12,13,14)/f/h12-13H > -0.595 > C8H10NO6P > 247.142 > CC1=NC=C(C(=C1O)C=O)COP(=O)(O)O > CC1=NC=C(C(=C1O)C=O)COP(=O)(O)O > 116.95 > 0 > 16 > 0 > 0 > 0 > 0 > 0 > 1 > 4 > 3320 > 2 > KEGG > C00018 > Is a reactant or product of enzyme EC 1.4.3.5 Is a reactant or product of enzyme EC 1.4.4.2 Is a reactant or product of enzyme EC 2.1.2.1 Is a reactant or product of enzyme EC 2.1.2.5 Is a reactant or product of enzyme EC 2.3.1.29 Is a reactant or product of enzyme EC 2.3.1.37 Is a reactant or product of enzyme EC 2.3.1.47 Is a reactant or product of enzyme EC 2.3.1.50 Is a reactant or product of enzyme EC 2.4.1.1 Is a reactant or product of enzyme EC 2.5.1.47 Is a reactant or product of enzyme EC 2.5.1.48 Is a reactant or product of enzyme EC 2.6.1.1 Is a reactant or product of enzyme EC 2.6.1.2 Is a reactant or product of enzyme EC 2.6.1.3 Is a reactant or product of enzyme EC 2.6.1.4 Is a reactant or product of enzyme EC 2.6.1.5 Is a reactant or product of enzyme EC 2.6.1.6 Is a reactant or product of enzyme EC 2.6.1.7 Is a reactant or product of enzyme EC 2.6.1.8 Is a reactant or product of enzyme EC 2.6.1.9 Is a reactant or product of enzyme EC 2.6.1.11 Is a reactant or product of enzyme EC 2.6.1.12 Is a reactant or product of enzyme EC 2.6.1.13 Is a reactant or product of enzyme EC 2.6.1.14 Is a reactant or product of enzyme EC 2.6.1.15 Is a reactant or product of enzyme EC 2.6.1.17 Is a reactant or product of enzyme EC 2.6.1.18 Is a reactant or product of enzyme EC 2.6.1.19 Is a reactant or product of enzyme EC 2.6.1.21 Is a reactant or product of enzyme EC 2.6.1.24 Is a reactant or product of enzyme EC 2.6.1.26 Is a reactant or product of enzyme EC 2.6.1.27 Is a reactant or product of enzyme EC 2.6.1.33 Is a reactant or product of enzyme EC 2.6.1.34 Is a reactant or product of enzyme EC 2.6.1.35 Is a reactant or product of enzyme EC 2.6.1.36 Is a reactant or product of enzyme EC 2.6.1.37 Is a reactant or product of enzyme EC 2.6.1.39 Is a reactant or product of enzyme EC 2.6.1.42 Is a reactant or product of enzyme EC 2.6.1.43 Is a reactant or product of enzyme EC 2.6.1.44 Is a reactant or product of enzyme EC 2.6.1.45 Is a reactant or product of enzyme EC 2.6.1.46 Is a reactant or product of enzyme EC 2.6.1.47 Is a reactant or product of enzyme EC 2.6.1.48 Is a reactant or product of enzyme EC 2.6.1.49 Is a reactant or product of enzyme EC 2.6.1.50 Is a reactant or product of enzyme EC 2.6.1.51 Is a reactant or product of enzyme EC 2.6.1.52 Is a reactant or product of enzyme EC 2.6.1.54 Is a reactant or product of enzyme EC 2.6.1.55 Is a reactant or product of enzyme EC 2.6.1.57 Is a reactant or product of enzyme EC 2.6.1.59 Is a reactant or product of enzyme EC 2.6.1.62 Is a reactant or product of enzyme EC 2.6.1.64 Is a reactant or product of enzyme EC 2.6.1.65 Is a reactant or product of enzyme EC 2.6.1.67 Is a reactant or product of enzyme EC 2.6.1.72 Is a reactant or product of enzyme EC 2.7.1.35 Is a reactant or product of enzyme EC 2.9.1.1 Is a reactant or product of enzyme EC 3.1.3.- Is a reactant or product of enzyme EC 3.5.99.7 Is a reactant or product of enzyme EC 3.7.1.3 Is a reactant or product of enzyme EC 4.1.1.12 Is a reactant or product of enzyme EC 4.1.1.14 Is a reactant or product of enzyme EC 4.1.1.15 Is a reactant or product of enzyme EC 4.1.1.16 Is a reactant or product of enzyme EC 4.1.1.17 Is a reactant or product of enzyme EC 4.1.1.18 Is a reactant or product of enzyme EC 4.1.1.19 Is a reactant or product of enzyme EC 4.1.1.20 Is a reactant or product of enzyme EC 4.1.1.22 Is a reactant or product of enzyme EC 4.1.1.24 Is a reactant or product of enzyme EC 4.1.1.25 Is a reactant or product of enzyme EC 4.1.1.28 Is a reactant or product of enzyme EC 4.1.1.29 Is a reactant or product of enzyme EC 4.1.1.53 Is a reactant or product of enzyme EC 4.1.1.64 Is a reactant or product of enzyme EC 4.1.1.65 Is a reactant or product of enzyme EC 4.1.2.5 Is a reactant or product of enzyme EC 4.1.2.26 Is a reactant or product of enzyme EC 4.1.2.27 Is a reactant or product of enzyme EC 4.1.99.1 Is a reactant or product of enzyme EC 4.1.99.2 Is a reactant or product of enzyme EC 4.2.1.20 Is a reactant or product of enzyme EC 4.2.1.22 Is a reactant or product of enzyme EC 4.2.1.50 Is a reactant or product of enzyme EC 4.2.3.1 Is a reactant or product of enzyme EC 4.2.3.2 Is a reactant or product of enzyme EC 4.3.1.9 Is a reactant or product of enzyme EC 4.3.1.13 Is a reactant or product of enzyme EC 4.3.1.15 Is a reactant or product of enzyme EC 4.3.1.17 Is a reactant or product of enzyme EC 4.3.1.18 Is a reactant or product of enzyme EC 4.3.1.19 Is a reactant or product of enzyme EC 4.3.1.20 Is a reactant or product of enzyme EC 4.3.1.21 Is a reactant or product of enzyme EC 4.4.1.1 Is a reactant or product of enzyme EC 4.4.1.2 Is a reactant or product of enzyme EC 4.4.1.4 Is a reactant or product of enzyme EC 4.4.1.6 Is a reactant or product of enzyme EC 4.4.1.8 Is a reactant or product of enzyme EC 4.4.1.10 Is a reactant or product of enzyme EC 4.4.1.11 Is a reactant or product of enzyme EC 4.4.1.13 Is a reactant or product of enzyme EC 4.4.1.14 Is a reactant or product of enzyme EC 4.4.1.16 Is a reactant or product of enzyme EC 4.5.1.2 Is a reactant or product of enzyme EC 4.5.1.5 Is a reactant or product of enzyme EC 5.1.1.1 Is a reactant or product of enzyme EC 5.1.1.2 Is a reactant or product of enzyme EC 5.1.1.9 Is a reactant or product of enzyme EC 5.1.1.10 Is a reactant or product of enzyme EC 5.4.3.2 Is a reactant or product of enzyme EC 5.4.3.5 Is a reactant or product of enzyme EC 5.4.3.8 > 54-47-7 C00018 Pyridoxal 5'-phosphate Pyridoxal 5-phosphate Pyridoxal phosphate > 54-47-7 > C00018 > 229661 229948 229949 229950 229951 229952 230414 230542 230800 230866 231016 231141 231213 231257 231258 231259 231260 231300 231322 231323 231324 231325 442597 442601 442605 442606 442607 442608 442634 442964 443270 443289 443290 443542 443543 443556 443557 443572 443573 493831 493832 493833 493834 493835 493836 494311 494312 494488 494490 494492 494494 494495 494496 494497 494624 494625 494626 494627 494628 494629 515077 515078 515079 515080 515081 515082 515083 575999 576000 576001 576002 640141 640142 640143 640144 640145 640146 640151 640152 640153 640156 640164 640165 640359 640360 640361 809192 809193 999900 1065301 1065302 1127088 1127089 1127164 1127165 1127182 1127183 1127184 1127185 1127186 1127187 1127188 1127189 1127190 1127191 1127192 1127193 1311169 1311170 1311171 1311172 1311173 1311174 1421252 1421253 1421254 1421255 1421415 1421416 1421417 1431671 1431672 1431673 1633146 1633147 1633521 1633522 1633523 1827888 1827889 1827890 1827891 1942328 1942329 2098381 2098382 2098383 2098384 2098385 2098386 2098388 2098389 2392156 2392157 2392158 2392159 2392380 2624861 2624862 2914379 2914380 2914381 2914382 2914396 2981895 2981896 2982001 2982002 2982008 2982009 3114488 3114489 3114490 3212298 3212299 3212300 3212365 3212366 3212367 3212368 3212748 3212749 3212821 3212822 3318706 3318708 3319059 3319060 3319072 3319073 3319074 3319078 3319079 3319080 3319081 3319082 3659998 3659999 3660167 3660168 3660169 3660170 3660282 3660283 3660284 3660285 3891550 3891551 3891552 3891553 3891941 3891942 3891967 3891968 3891969 3891970 3891971 3891972 4139594 4139595 4139654 4139655 4139656 4388895 4388901 4388902 4388903 4388904 4388905 4388906 4388907 4388908 4388909 4388910 4388911 4388912 4388913 4388914 4388915 4388916 4388917 4388918 4558003 4558004 4558012 4558013 4699587 4699588 4699590 4699591 4699592 4699619 4699620 4699723 4699724 5107512 5107513 5107514 5107515 5542506 5542507 5821827 5821836 5821837 5821839 5821840 5821841 5821842 5821886 5822508 5822509 5822524 5822525 5822526 5822527 5822528 5822529 6137418 6137419 6137743 6137744 6435612 6573481 6573482 6573483 6573484 6573538 6573539 6573540 6573541 6573548 6573549 6573550 6573551 6729697 6729759 6729822 6729832 6729833 6729837 6729838 6729839 6729901 6730143 6730159 6730160 6730203 6730204 6730206 6730207 6730323 6730324 6730325 6730326 6730422 6980404 6980405 6980564 6980565 6980600 6980601 6980678 6980679 7245554 7245555 7245633 7245744 7245745 7246003 7246004 7767017 7767018 7767019 7767020 8569323 8569398 8569507 9257024 9257025 9257026 9257027 9257156 9257157 9257158 9955129 10120741 10120742 10120743 10120835 10120893 10120894 10835439 10835441 10835442 10835443 10835444 10835445 10835446 10835850 11513353 11513355 11513357 11513359 11513365 11513367 11513499 11513500 11513501 11513502 11513597 11513598 11513721 11513722 11513797 11513798 11513799 11513800 11514068 11514069 11514070 11514071 11514105 11514106 11514121 11514122 11514255 11514273 11514289 11514290 12084330 12084331 12084332 12084333 12084524 12084525 12084528 12084604 12084728 13096580 13096581 13786630 13786631 13786632 13786633 13786634 13786635 13786765 13786766 13786767 13786771 13786772 13786971 13786972 13786973 13786974 14278152 14278153 14278468 14278469 14278520 14719457 14719458 14719459 14719460 14719461 14719462 14719463 14719464 14719465 14719479 14719481 14719482 14719483 14719484 14719514 15825696 15825697 15825698 15825699 15825700 15825701 15825993 15826191 15826192 15826193 15826194 15826454 15826455 15826456 15826457 15826458 15826459 15826460 15826461 15826462 15826463 15826464 15826465 15826616 15826678 15826679 15988099 15988100 16975044 16975045 16975046 16975047 16975186 16975187 17942613 17942614 18158926 18158927 18655557 20150135 20150136 20150137 20150138 20150139 20150140 20150141 20150142 20150143 20150144 20150145 20150146 20150147 20150148 20150149 20150150 20150151 20150152 20150153 20150154 20150155 20150156 20150157 20150158 20664287 20664288 20664291 20664292 20664295 20664296 21465427 21465428 21465429 21465430 21465431 21465432 21465433 21465434 21465981 21465982 21465983 21465984 21730349 21730350 21730351 21730418 21730419 21730424 21730425 21730439 21730440 21730441 21730442 21730869 21730870 22218914 22218915 22218916 22218917 22219039 22219040 22219042 22219043 22219044 23200446 23200447 23200448 23200449 23200450 23200451 24987659 24987660 24987661 24987662 27065242 27065243 27065246 27065247 27065325 27065326 27065354 27065355 27065530 27065531 27065532 27065533 27065534 27065535 27065653 27065654 27065673 27065674 27065675 27065676 27066022 27066023 27066024 27066025 27573695 27573696 27573773 27573774 27573804 27573805 27573806 27573807 27573808 27573809 27573810 27573811 27573850 27573851 27573852 27573853 27573855 28373266 28373267 28373268 28373269 28373431 28373432 28373461 28373462 28373551 28373552 28373553 28373554 28948482 28948483 28948484 28948485 29726280 29726281 29726282 29726283 29726500 29726501 29726502 29726503 29726504 29726505 29726506 29726507 29726508 29726509 29726510 29726511 29726530 29726531 29726532 29726533 29726534 29726535 29726536 29726537 29726538 29726539 29726540 29726541 29726542 29726543 29726544 29726545 29726546 29726547 30749292 30749293 30749294 30749295 30749296 30749297 30749447 30749773 30749774 30749775 33356965 33357044 33357643 33357644 34809903 34809904 34809905 34809906 34810049 34810050 34810051 34810052 34810068 34810069 34810070 34810071 34810106 34810107 34810108 34810109 34810110 34810111 34810213 34810214 34810215 34810216 34810385 37926920 37926921 38492419 38492420 38492421 38492422 38492634 38492635 38492636 38492637 38492638 38492639 38492640 38492641 38492642 38492643 38492644 38492645 39654064 39654106 39654107 39654562 39654563 39654564 39654565 39654566 39654567 39654568 39654569 39654570 39654571 39654919 39654920 39654921 39654922 40889030 40889031 40889032 40889033 40889885 40889886 40889887 40889888 40889995 40889996 40889997 40889998 42543461 46015233 46015234 46015235 46015236 46015237 46015238 46015239 46015240 46015241 46015242 46015243 46015244 47168326 47168327 47168328 47168329 47168923 47168924 47168925 47168926 47168927 47168928 47168929 47168930 47168931 47168932 47169279 47169280 47169281 47169282 47169283 47169284 47169460 48425318 48425319 48425320 48425321 48425322 48425323 48425324 48425325 48425326 48425327 48425328 48425754 48425755 48425756 48425757 48425758 48425759 48425760 48425761 49258414 49258415 49258416 49258417 49258479 49258480 49258481 49258482 49258690 49259393 49259394 49259395 49259396 49259424 50513409 50513410 50513411 50513412 50513413 50513414 50513415 50513416 50513919 50513920 50513921 50513922 50513923 51247626 51247627 51247744 51247745 51247766 51247767 51247768 51247769 52695319 52695320 52695401 52695402 52695403 52695404 52695581 52695582 55669720 55669721 55669722 55669723 55669724 55669725 55669726 55669727 55669973 55669974 55669975 55669976 55669977 55669978 55669979 55670437 55670438 55670439 55670440 55670441 55670655 55670656 55670657 55670836 55670837 56553801 56553802 56553803 56553804 56554052 56554053 56554054 56554055 56554056 56554057 56554058 56554059 56554068 56554069 56554070 56554071 56554072 56554073 56554074 56554075 56554084 56554085 56554086 56554087 56554170 56554171 56554172 56554173 56554464 56554465 56554468 56554469 58176564 58176565 58177080 58177081 58177086 58177244 58177245 60593956 60594046 60594047 60594048 60594049 61679972 61679973 61679974 61679975 61679976 61679977 61679978 61679979 61679980 61679981 61679982 61679983 61680098 61680101 61680102 61680106 61680107 61680108 61680109 61680224 61680225 61680365 62738333 62738334 62738335 62738336 62738337 62738338 62738339 62738340 62738341 62738342 62738343 62738344 62738345 62738346 62738347 62738348 62738349 62738350 62738351 62738352 62738462 62738463 62738464 66360289 66360294 66360295 66360296 66360297 66360375 66360545 66360546 66360676 66360677 66361107 66361339 66361340 67463727 67463728 67464100 67464101 67464102 67464103 67464104 67464105 67464106 67464107 67464108 67464109 67464110 67464111 67464112 67464113 67464114 67464115 67464116 67464117 67464482 67464483 67464484 67464485 71041625 71041626 71041627 71041628 71041761 71041927 71041928 71041929 71041930 71041931 71041932 71041978 71042031 71042032 71042033 71042050 71042633 71042634 71042635 71042636 71042637 71042638 71042639 71042640 73535402 73535403 73535404 73535405 73535406 73535407 73535408 73535409 73535410 73535411 73535412 73535413 73535824 73535825 73535826 73535827 73535828 73535829 73536169 > http://www.genome.jp/kegg/kegg2.html > http://www.genome.jp/dbget-bin/www_bget?cpd+C00018 > 1051 1 > 2 6 8 2 9 8 5 8 8 5 9 8 6 7 8 7 8 8 $$$$